C19H30BN3O7S — CID 99867510
(2S)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]propan-1-one (PubChem CID 99867510) has the molecular formula C19H30BN3O7S and a molecular weight of 455.34 g/mol. Its IUPAC name is (2S)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2S)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99867510 |
| Molecular Formula | C19H30BN3O7S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2S)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(S(=O)(=O)C[C@@H]3CCCN(C(=O)[C@@H](O)CO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C19H30BN3O7S/c1-18(2)19(3,4)30-20(29-18)14-8-21-17(22-9-14)31(27,28)12-13-6-5-7-23(10-13)16(26)15(25)11-24/h8-9,13,15,24-25H,5-7,10-12H2,1-4H3/t13-,15+/m1/s1 |
| InChIKey | NWMPJHFLBWSVBN-HIFRSBDPSA-N |
| XLogP | -0.86 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|