C18H28BN3O7S — CID 99867496
(2R)-2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-1-one (PubChem CID 99867496) has the molecular formula C18H28BN3O7S and a molecular weight of 441.32 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99867496 |
| Molecular Formula | C18H28BN3O7S |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2R)-2,3-dihydroxy-1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpiperidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(S(=O)(=O)C3CCN(C(=O)[C@H](O)CO)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C18H28BN3O7S/c1-17(2)18(3,4)29-19(28-17)12-9-20-16(21-10-12)30(26,27)13-5-7-22(8-6-13)15(25)14(24)11-23/h9-10,13-14,23-24H,5-8,11H2,1-4H3/t14-/m1/s1 |
| InChIKey | LGDJQRBFRMSYHE-CQSZACIVSA-N |
| XLogP | -1.11 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|