C19H30BN3O6 — CID 99867688
(2R)-2,3-dihydroxy-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-1-one (PubChem CID 99867688) has the molecular formula C19H30BN3O6 and a molecular weight of 407.28 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2,3-dihydroxy-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99867688 |
| Molecular Formula | C19H30BN3O6 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (2R)-2,3-dihydroxy-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(OCC3CCN(C(=O)[C@H](O)CO)CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C19H30BN3O6/c1-18(2)19(3,4)29-20(28-18)14-9-21-17(22-10-14)27-12-13-5-7-23(8-6-13)16(26)15(25)11-24/h9-10,13,15,24-25H,5-8,11-12H2,1-4H3/t15-/m1/s1 |
| InChIKey | MPDFJPVBUQPSNP-OAHLLOKOSA-N |
| XLogP | -0.25 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|