C22H35BN4O5 — CID 99867414
(2R)-1-[4-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-2,3-dihydroxypropan-1-one (PubChem CID 99867414) has the molecular formula C22H35BN4O5 and a molecular weight of 446.36 g/mol. Its IUPAC name is (2R)-1-[4-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-2,3-dihydroxypropan-1-one.
| Compound Name | (2R)-1-[4-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 99867414 |
| Molecular Formula | C22H35BN4O5 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2R)-1-[4-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-2,3-dihydroxypropan-1-one |
| SMILES | CC1(C)OB(c2cnc(N(CC3CCN(C(=O)[C@H](O)CO)CC3)C3CC3)nc2)OC1(C)C |
| InChI | InChI=1S/C22H35BN4O5/c1-21(2)22(3,4)32-23(31-21)16-11-24-20(25-12-16)27(17-5-6-17)13-15-7-9-26(10-8-15)19(30)18(29)14-28/h11-12,15,17-18,28-29H,5-10,13-14H2,1-4H3/t18-/m1/s1 |
| InChIKey | FCYBTUUOLNXZIK-GOSISDBHSA-N |
| XLogP | 0.34 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|