C24H39BN4O6 — CID 71633521
tert-butyl N-[1-oxo-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-2-yl]carbamate (PubChem CID 71633521) has the molecular formula C24H39BN4O6 and a molecular weight of 490.41 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71633521 |
| Molecular Formula | C24H39BN4O6 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | tert-butyl N-[1-oxo-1-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]piperidin-1-yl]propan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)N1CCC(COc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C24H39BN4O6/c1-16(28-21(31)33-22(2,3)4)19(30)29-11-9-17(10-12-29)15-32-20-26-13-18(14-27-20)25-34-23(5,6)24(7,8)35-25/h13-14,16-17H,9-12,15H2,1-8H3,(H,28,31) |
| InChIKey | AWHFFUROXUFTMG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|