C22H35BN4O5S — CID 99867157
tert-butyl N-[(2S)-1-oxo-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpyrrolidin-1-yl]propan-2-yl]carbamate (PubChem CID 99867157) has the molecular formula C22H35BN4O5S and a molecular weight of 478.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpyrrolidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpyrrolidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 99867157 |
| Molecular Formula | C22H35BN4O5S |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-[(3R)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpyrrolidin-1-yl]propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](Sc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C22H35BN4O5S/c1-14(26-19(29)30-20(2,3)4)17(28)27-10-9-16(13-27)33-18-24-11-15(12-25-18)23-31-21(5,6)22(7,8)32-23/h11-12,14,16H,9-10,13H2,1-8H3,(H,26,29)/t14-,16+/m0/s1 |
| InChIKey | HKPBKBKNZZUJJN-GOEBONIOSA-N |
| XLogP | 2.38 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|