C23H38BN5O5 — CID 99867147
tert-butyl N-[(2S)-1-[(3R)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 99867147) has the molecular formula C23H38BN5O5 and a molecular weight of 475.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(3R)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(3R)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 99867147 |
| Molecular Formula | C23H38BN5O5 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(3R)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](N(C)c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C23H38BN5O5/c1-15(27-20(31)32-21(2,3)4)18(30)29-11-10-17(14-29)28(9)19-25-12-16(13-26-19)24-33-22(5,6)23(7,8)34-24/h12-13,15,17H,10-11,14H2,1-9H3,(H,27,31)/t15-,17+/m0/s1 |
| InChIKey | DZCYKKVZKJAGBC-DOTOQJQBSA-N |
| XLogP | 1.73 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|