C26H44BN5O5 — CID 99884606
tert-butyl N-[(2S)-3-methyl-1-[(3S)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 99884606) has the molecular formula C26H44BN5O5 and a molecular weight of 517.48 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-[(3S)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-[(3S)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 99884606 |
| Molecular Formula | C26H44BN5O5 |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-[(3S)-3-[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H](N(C)c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C26H44BN5O5/c1-17(2)20(30-23(34)35-24(3,4)5)21(33)32-13-11-12-19(16-32)31(10)22-28-14-18(15-29-22)27-36-25(6,7)26(8,9)37-27/h14-15,17,19-20H,11-13,16H2,1-10H3,(H,30,34)/t19-,20-/m0/s1 |
| InChIKey | UDIWJIIOJDCDHE-PMACEKPBSA-N |
| XLogP | 2.75 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|