C24H39BN4O7S — CID 71632624
tert-butyl N-[3-methyl-1-oxo-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 71632624) has the molecular formula C24H39BN4O7S and a molecular weight of 538.48 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-oxo-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-oxo-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 71632624 |
| Molecular Formula | C24H39BN4O7S |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | tert-butyl N-[3-methyl-1-oxo-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylpyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CCC(S(=O)(=O)c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C24H39BN4O7S/c1-15(2)18(28-21(31)34-22(3,4)5)19(30)29-11-10-17(14-29)37(32,33)20-26-12-16(13-27-20)25-35-23(6,7)24(8,9)36-25/h12-13,15,17-18H,10-11,14H2,1-9H3,(H,28,31) |
| InChIKey | AUVLZPOIMAFRMT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|