C29H50BN5O5 — CID 71632640
tert-butyl N-[3-methyl-1-oxo-1-[4-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 71632640) has the molecular formula C29H50BN5O5 and a molecular weight of 559.56 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-oxo-1-[4-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-oxo-1-[4-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 71632640 |
| Molecular Formula | C29H50BN5O5 |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.39 |
| IUPAC Name | tert-butyl N-[3-methyl-1-oxo-1-[4-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CCC(CN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C(C)C)CC1 |
| InChI | InChI=1S/C29H50BN5O5/c1-19(2)23(33-26(37)38-27(5,6)7)24(36)34-14-12-21(13-15-34)18-35(20(3)4)25-31-16-22(17-32-25)30-39-28(8,9)29(10,11)40-30/h16-17,19-21,23H,12-15,18H2,1-11H3,(H,33,37) |
| InChIKey | FCSPEKVXRGEWCF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|