C25H42BN5O5 — CID 99884610
tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 99884610) has the molecular formula C25H42BN5O5 and a molecular weight of 503.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 99884610 |
| Molecular Formula | C25H42BN5O5 |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | tert-butyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H](Nc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C25H42BN5O5/c1-16(2)19(30-22(33)34-23(3,4)5)20(32)31-12-10-11-18(15-31)29-21-27-13-17(14-28-21)26-35-24(6,7)25(8,9)36-26/h13-14,16,18-19H,10-12,15H2,1-9H3,(H,30,33)(H,27,28,29)/t18-,19-/m0/s1 |
| InChIKey | WWIVPZPWJJOETF-OALUTQOASA-N |
| XLogP | 2.73 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|