C27H44BN5O5 — CID 99867265
tert-butyl N-[(2R)-1-[(3R)-3-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 99867265) has the molecular formula C27H44BN5O5 and a molecular weight of 529.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(3R)-3-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(3R)-3-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 99867265 |
| Molecular Formula | C27H44BN5O5 |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(3R)-3-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H](CN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C2CC2)C1 |
| InChI | InChI=1S/C27H44BN5O5/c1-18(31-24(35)36-25(2,3)4)22(34)32-13-9-10-19(16-32)17-33(21-11-12-21)23-29-14-20(15-30-23)28-37-26(5,6)27(7,8)38-28/h14-15,18-19,21H,9-13,16-17H2,1-8H3,(H,31,35)/t18-,19+/m1/s1 |
| InChIKey | JVWMKMSTQJEIQY-MOPGFXCFSA-N |
| XLogP | 2.90 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|