C23H37BN4O6 — CID 71633520
tert-butyl N-[1-oxo-1-[3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]pyrrolidin-1-yl]propan-2-yl]carbamate (PubChem CID 71633520) has the molecular formula C23H37BN4O6 and a molecular weight of 476.38 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-[3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]pyrrolidin-1-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-[3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]pyrrolidin-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71633520 |
| Molecular Formula | C23H37BN4O6 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | tert-butyl N-[1-oxo-1-[3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxymethyl]pyrrolidin-1-yl]propan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)N1CCC(COc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C23H37BN4O6/c1-15(27-20(30)32-21(2,3)4)18(29)28-10-9-16(13-28)14-31-19-25-11-17(12-26-19)24-33-22(5,6)23(7,8)34-24/h11-12,15-16H,9-10,13-14H2,1-8H3,(H,27,30) |
| InChIKey | MMENNOHLJOQDOS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|