C18H29BN4O5 — CID 99867372
(2R)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one (PubChem CID 99867372) has the molecular formula C18H29BN4O5 and a molecular weight of 392.27 g/mol. Its IUPAC name is (2R)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99867372 |
| Molecular Formula | C18H29BN4O5 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2R)-2,3-dihydroxy-1-[(3R)-3-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]piperidin-1-yl]propan-1-one |
| SMILES | CC1(C)OB(c2cnc(N[C@@H]3CCCN(C(=O)[C@H](O)CO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C18H29BN4O5/c1-17(2)18(3,4)28-19(27-17)12-8-20-16(21-9-12)22-13-6-5-7-23(10-13)15(26)14(25)11-24/h8-9,13-14,24-25H,5-7,10-11H2,1-4H3,(H,20,21,22)/t13-,14-/m1/s1 |
| InChIKey | IYJYZZJCKBTHIR-ZIAGYGMSSA-N |
| XLogP | -0.47 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|