C21H37BN4O3 — CID 99884856
2-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanol (PubChem CID 99884856) has the molecular formula C21H37BN4O3 and a molecular weight of 404.36 g/mol. Its IUPAC name is 2-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 99884856 |
| Molecular Formula | C21H37BN4O3 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | 2-[(3R)-3-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidin-1-yl]ethanol |
| SMILES | CC(C)N(C[C@@H]1CCCN(CCO)C1)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C21H37BN4O3/c1-16(2)26(15-17-8-7-9-25(14-17)10-11-27)19-23-12-18(13-24-19)22-28-20(3,4)21(5,6)29-22/h12-13,16-17,27H,7-11,14-15H2,1-6H3/t17-/m1/s1 |
| InChIKey | CVPXGLYYEHGLRY-QGZVFWFLSA-N |
| XLogP | 1.69 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|