C27H45BN4O7S — CID 71632698
tert-butyl N-[3-methyl-1-oxo-1-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]butan-2-yl]carbamate (PubChem CID 71632698) has the molecular formula C27H45BN4O7S and a molecular weight of 580.56 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-oxo-1-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-oxo-1-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 71632698 |
| Molecular Formula | C27H45BN4O7S |
| Molecular Weight | 580.56 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | tert-butyl N-[3-methyl-1-oxo-1-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylethyl]piperidin-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)N1CCCCC1CCS(=O)(=O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C27H45BN4O7S/c1-18(2)21(31-24(34)37-25(3,4)5)22(33)32-14-11-10-12-20(32)13-15-40(35,36)23-29-16-19(17-30-23)28-38-26(6,7)27(8,9)39-28/h16-18,20-21H,10-15H2,1-9H3,(H,31,34) |
| InChIKey | LYKNNOAGNWKQSC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 137.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|