C21H34BN3O6S — CID 99884461
tert-butyl (2S)-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidine-1-carboxylate (PubChem CID 99884461) has the molecular formula C21H34BN3O6S and a molecular weight of 467.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 99884461 |
| Molecular Formula | C21H34BN3O6S |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | tert-butyl (2S)-2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfonylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1CS(=O)(=O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C21H34BN3O6S/c1-19(2,3)29-18(26)25-11-9-8-10-16(25)14-32(27,28)17-23-12-15(13-24-17)22-30-20(4,5)21(6,7)31-22/h12-13,16H,8-11,14H2,1-7H3/t16-/m0/s1 |
| InChIKey | PEROGJPZAFKMDZ-INIZCTEOSA-N |
| XLogP | 2.34 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|