C23H38BN3O4S — CID 71631605
tert-butyl 2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidine-1-carboxylate (PubChem CID 71631605) has the molecular formula C23H38BN3O4S and a molecular weight of 463.45 g/mol. Its IUPAC name is tert-butyl 2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631605 |
| Molecular Formula | C23H38BN3O4S |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | tert-butyl 2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CCCSc1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C23H38BN3O4S/c1-21(2,3)29-20(28)27-13-9-8-11-18(27)12-10-14-32-19-25-15-17(16-26-19)24-30-22(4,5)23(6,7)31-24/h15-16,18H,8-14H2,1-7H3 |
| InChIKey | PTYINEFUJXHZSE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|