C23H37BN4O4 — CID 71631304
tert-butyl 2-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 71631304) has the molecular formula C23H37BN4O4 and a molecular weight of 444.39 g/mol. Its IUPAC name is tert-butyl 2-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71631304 |
| Molecular Formula | C23H37BN4O4 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | tert-butyl 2-[[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CN(c1ncc(B2OC(C)(C)C(C)(C)O2)cn1)C1CC1 |
| InChI | InChI=1S/C23H37BN4O4/c1-21(2,3)30-20(29)27-12-8-9-18(27)15-28(17-10-11-17)19-25-13-16(14-26-19)24-31-22(4,5)23(6,7)32-24/h13-14,17-18H,8-12,15H2,1-7H3 |
| InChIKey | DTPNNYULQFOORV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|