C22H37BN4O4 — CID 99867914
tert-butyl (3S)-3-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidine-1-carboxylate (PubChem CID 99867914) has the molecular formula C22H37BN4O4 and a molecular weight of 432.37 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 99867914 |
| Molecular Formula | C22H37BN4O4 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | tert-butyl (3S)-3-[[methyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CN(C[C@@H]1CCCN(C(=O)OC(C)(C)C)C1)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C22H37BN4O4/c1-20(2,3)29-19(28)27-11-9-10-16(15-27)14-26(8)18-24-12-17(13-25-18)23-30-21(4,5)22(6,7)31-23/h12-13,16H,9-11,14-15H2,1-8H3/t16-/m0/s1 |
| InChIKey | WEAFBYGGTCAZNG-INIZCTEOSA-N |
| XLogP | 2.86 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|