C21H34BN3O4 — CID 172644826
tert-butyl 3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-1-carboxylate (PubChem CID 172644826) has the molecular formula C21H34BN3O4 and a molecular weight of 403.33 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172644826 |
| Molecular Formula | C21H34BN3O4 |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | tert-butyl 3-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCC1c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C21H34BN3O4/c1-14-13-25(18(26)27-19(2,3)4)10-9-16(14)17-23-11-15(12-24-17)22-28-20(5,6)21(7,8)29-22/h11-12,14,16H,9-10,13H2,1-8H3 |
| InChIKey | AOKAGOGLJVWFNZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|