C20H32BN3O4 — CID 176583084
tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,3-diazinane-1-carboxylate (PubChem CID 176583084) has the molecular formula C20H32BN3O4 and a molecular weight of 389.31 g/mol. Its IUPAC name is tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,3-diazinane-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 176583084 |
| Molecular Formula | C20H32BN3O4 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,3-diazinane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)NC1 |
| InChI | InChI=1S/C20H32BN3O4/c1-18(2,3)26-17(25)24-11-10-16(23-13-24)15-9-8-14(12-22-15)21-27-19(4,5)20(6,7)28-21/h8-9,12,16,23H,10-11,13H2,1-7H3 |
| InChIKey | YWWNGSBNCBUGSO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|