C36H56BBrN6O6 — CID 159641063
tert-butyl 4-[(5-bromo-2-pyridinyl)methyl]piperazine-1-carboxylate;tert-butyl 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 159641063) has the molecular formula C36H56BBrN6O6 and a molecular weight of 759.60 g/mol. Its IUPAC name is tert-butyl 4-[(5-bromo-2-pyridinyl)methyl]piperazine-1-carboxylate;tert-butyl 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-bromo-2-pyridinyl)methyl]piperazine-1-carboxylate;tert-butyl 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159641063 |
| Molecular Formula | C36H56BBrN6O6 |
| Molecular Weight | 759.60 g/mol |
| Exact Mass | 758.35 |
| IUPAC Name | tert-butyl 4-[(5-bromo-2-pyridinyl)methyl]piperazine-1-carboxylate;tert-butyl 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cn2)CC1.CC(C)(C)OC(=O)N1CCN(Cc2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C21H34BN3O4.C15H22BrN3O2/c1-19(2,3)27-18(26)25-12-10-24(11-13-25)15-17-9-8-16(14-23-17)22-28-20(4,5)21(6,7)29-22;1-15(2,3)21-14(20)19-8-6-18(7-9-19)11-13-5-4-12(16)10-17-13/h8-9,14H,10-13,15H2,1-7H3;4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | MQIYPEWNVIPSFA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|