C26H37BN4O5 — CID 172623385
tert-butyl 4-[5-[hydroxy-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 172623385) has the molecular formula C26H37BN4O5 and a molecular weight of 496.42 g/mol. Its IUPAC name is tert-butyl 4-[5-[hydroxy-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[hydroxy-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 172623385 |
| Molecular Formula | C26H37BN4O5 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | tert-butyl 4-[5-[hydroxy-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(C(O)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cn2)CC1 |
| InChI | InChI=1S/C26H37BN4O5/c1-24(2,3)34-23(33)31-14-12-30(13-15-31)22-28-16-19(17-29-22)21(32)18-8-10-20(11-9-18)27-35-25(4,5)26(6,7)36-27/h8-11,16-17,21,32H,12-15H2,1-7H3 |
| InChIKey | RIXCSDGEAWOHIA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|