C23H33BF3N3O5 — CID 140760038
tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]piperazine-1-carboxylate (PubChem CID 140760038) has the molecular formula C23H33BF3N3O5 and a molecular weight of 499.34 g/mol. Its IUPAC name is tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140760038 |
| Molecular Formula | C23H33BF3N3O5 |
| Molecular Weight | 499.34 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | tert-butyl 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-[(2,2,2-trifluoroacetyl)amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(B3OC(C)(C)C(C)(C)O3)ccc2NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H33BF3N3O5/c1-20(2,3)33-19(32)30-12-10-29(11-13-30)17-14-15(24-34-21(4,5)22(6,7)35-24)8-9-16(17)28-18(31)23(25,26)27/h8-9,14H,10-13H2,1-7H3,(H,28,31) |
| InChIKey | SZZSESQBZYQBSZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|