C25H37BFNO5 — CID 171070870
tert-butyl 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 171070870) has the molecular formula C25H37BFNO5 and a molecular weight of 461.38 g/mol. Its IUPAC name is tert-butyl 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-7-azaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-7-azaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 171070870 |
| Molecular Formula | C25H37BFNO5 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl 2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(Oc1ccc(B3OC(C)(C)C(C)(C)O3)cc1F)C2 |
| InChI | InChI=1S/C25H37BFNO5/c1-22(2,3)31-21(29)28-12-10-25(11-13-28)15-18(16-25)30-20-9-8-17(14-19(20)27)26-32-23(4,5)24(6,7)33-26/h8-9,14,18H,10-13,15-16H2,1-7H3 |
| InChIKey | SHGYPELQCLAGOI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|