C27H43BN2O4 — CID 169095108
tert-butyl 9-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 169095108) has the molecular formula C27H43BN2O4 and a molecular weight of 470.46 g/mol. Its IUPAC name is tert-butyl 9-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 169095108 |
| Molecular Formula | C27H43BN2O4 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | tert-butyl 9-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCN(Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H43BN2O4/c1-24(2,3)32-23(31)30-18-14-27(15-19-30)12-16-29(17-13-27)20-21-8-10-22(11-9-21)28-33-25(4,5)26(6,7)34-28/h8-11H,12-20H2,1-7H3 |
| InChIKey | HEBCMRDWIJNWIW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|