C20H31BN2O4 — CID 70648380
tert-butyl 4-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 70648380) has the molecular formula C20H31BN2O4 and a molecular weight of 374.29 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70648380 |
| Molecular Formula | C20H31BN2O4 |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | tert-butyl 4-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(B3OCC(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C20H31BN2O4/c1-19(2,3)26-18(24)23-12-10-22(11-13-23)14-16-6-8-17(9-7-16)21-25-15-20(4,5)27-21/h6-9H,10-15H2,1-5H3 |
| InChIKey | VUNZFWCJFSSJFT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|