C23H37BN2O4 — CID 57374663
tert-butyl 4-[[3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-1,4-diazepane-1-carboxylate (PubChem CID 57374663) has the molecular formula C23H37BN2O4 and a molecular weight of 416.37 g/mol. Its IUPAC name is tert-butyl 4-[[3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 57374663 |
| Molecular Formula | C23H37BN2O4 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | tert-butyl 4-[[3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC1CC(C)(C)OB(c2cccc(CN3CCCN(C(=O)OC(C)(C)C)CC3)c2)O1 |
| InChI | InChI=1S/C23H37BN2O4/c1-18-16-23(5,6)30-24(29-18)20-10-7-9-19(15-20)17-25-11-8-12-26(14-13-25)21(27)28-22(2,3)4/h7,9-10,15,18H,8,11-14,16-17H2,1-6H3 |
| InChIKey | MYBPECSUBONZMY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|