C25H39BN2O4 — CID 169095105
tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 169095105) has the molecular formula C25H39BN2O4 and a molecular weight of 442.41 g/mol. Its IUPAC name is tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 169095105 |
| Molecular Formula | C25H39BN2O4 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | tert-butyl 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(Cc1ccc(B3OC(C)(C)C(C)(C)O3)cc1)C2 |
| InChI | InChI=1S/C25H39BN2O4/c1-22(2,3)30-21(29)28-14-12-25(13-15-28)17-27(18-25)16-19-8-10-20(11-9-19)26-31-23(4,5)24(6,7)32-26/h8-11H,12-18H2,1-7H3 |
| InChIKey | WAAMSVGRSMRYDG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|