C20H30N2O2 — CID 139877676
tert-butyl 2-benzyl-2,8-diazaspiro[3.6]decane-8-carboxylate (PubChem CID 139877676) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl 2-benzyl-2,8-diazaspiro[3.6]decane-8-carboxylate.
| Compound Name | tert-butyl 2-benzyl-2,8-diazaspiro[3.6]decane-8-carboxylate |
|---|---|
| PubChem CID | 139877676 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl 2-benzyl-2,8-diazaspiro[3.6]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(CC1)CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H30N2O2/c1-19(2,3)24-18(23)22-12-7-10-20(11-13-22)15-21(16-20)14-17-8-5-4-6-9-17/h4-6,8-9H,7,10-16H2,1-3H3 |
| InChIKey | LCGNNJHJCDXUOQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |