C21H32N2O2 — CID 59818863
tert-butyl 9-benzyl-2,9-diazaspiro[4.6]undecane-2-carboxylate (PubChem CID 59818863) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is tert-butyl 9-benzyl-2,9-diazaspiro[4.6]undecane-2-carboxylate.
| Compound Name | tert-butyl 9-benzyl-2,9-diazaspiro[4.6]undecane-2-carboxylate |
|---|---|
| PubChem CID | 59818863 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl 9-benzyl-2,9-diazaspiro[4.6]undecane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H32N2O2/c1-20(2,3)25-19(24)23-15-12-21(17-23)10-7-13-22(14-11-21)16-18-8-5-4-6-9-18/h4-6,8-9H,7,10-17H2,1-3H3 |
| InChIKey | FFKHFKDEMVLKAB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |