C24H32BF2N3O5 — CID 153382060
tert-butyl 4-fluoro-4-[8-fluoro-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-2-yl]piperidine-1-carboxylate (PubChem CID 153382060) has the molecular formula C24H32BF2N3O5 and a molecular weight of 491.34 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-[8-fluoro-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-[8-fluoro-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 153382060 |
| Molecular Formula | C24H32BF2N3O5 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | tert-butyl 4-fluoro-4-[8-fluoro-4-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(c2nc3c(F)cc(B4OC(C)(C)C(C)(C)O4)cc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C24H32BF2N3O5/c1-21(2,3)33-20(32)30-10-8-24(27,9-11-30)19-28-17-15(18(31)29-19)12-14(13-16(17)26)25-34-22(4,5)23(6,7)35-25/h12-13H,8-11H2,1-7H3,(H,28,29,31) |
| InChIKey | QZZIAWRDDZUAGW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|