C23H37BN2O4 — CID 166461383
tert-butyl 4-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate (PubChem CID 166461383) has the molecular formula C23H37BN2O4 and a molecular weight of 416.37 g/mol. Its IUPAC name is tert-butyl 4-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166461383 |
| Molecular Formula | C23H37BN2O4 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | tert-butyl 4-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H37BN2O4/c1-16-14-18(24-29-22(6,7)23(8,9)30-24)15-17(2)19(16)25-10-12-26(13-11-25)20(27)28-21(3,4)5/h14-15H,10-13H2,1-9H3 |
| InChIKey | IUFRFHBFVZTVAT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|