C19H32BN3O4S — CID 167720699
tert-butyl 4-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperazine-1-carboxylate (PubChem CID 167720699) has the molecular formula C19H32BN3O4S and a molecular weight of 409.36 g/mol. Its IUPAC name is tert-butyl 4-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167720699 |
| Molecular Formula | C19H32BN3O4S |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | tert-butyl 4-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]piperazine-1-carboxylate |
| SMILES | Cc1nc(N2CCN(C(=O)OC(C)(C)C)CC2)sc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H32BN3O4S/c1-13-14(20-26-18(5,6)19(7,8)27-20)28-15(21-13)22-9-11-23(12-10-22)16(24)25-17(2,3)4/h9-12H2,1-8H3 |
| InChIKey | ZWKNTWPSVOOPAW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|