C18H29BN2O4S — CID 172645264
tert-butyl 3-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]azetidine-1-carboxylate (PubChem CID 172645264) has the molecular formula C18H29BN2O4S and a molecular weight of 380.32 g/mol. Its IUPAC name is tert-butyl 3-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 172645264 |
| Molecular Formula | C18H29BN2O4S |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl 3-[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]azetidine-1-carboxylate |
| SMILES | Cc1nc(C2CN(C(=O)OC(C)(C)C)C2)sc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H29BN2O4S/c1-11-13(19-24-17(5,6)18(7,8)25-19)26-14(20-11)12-9-21(10-12)15(22)23-16(2,3)4/h12H,9-10H2,1-8H3 |
| InChIKey | XVDOUYJFUUXFHA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|