C21H29BN2O4 — CID 172645587
tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate (PubChem CID 172645587) has the molecular formula C21H29BN2O4 and a molecular weight of 384.29 g/mol. Its IUPAC name is tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 172645587 |
| Molecular Formula | C21H29BN2O4 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl 3-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2C#N)C1 |
| InChI | InChI=1S/C21H29BN2O4/c1-19(2,3)26-18(25)24-12-15(13-24)17-9-8-16(10-14(17)11-23)22-27-20(4,5)21(6,7)28-22/h8-10,15H,12-13H2,1-7H3 |
| InChIKey | HWSKALMZVNHKPY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|