C26H36BN3O6 — CID 168895387
tert-butyl 3-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate (PubChem CID 168895387) has the molecular formula C26H36BN3O6 and a molecular weight of 497.40 g/mol. Its IUPAC name is tert-butyl 3-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 168895387 |
| Molecular Formula | C26H36BN3O6 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | tert-butyl 3-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridazin-3-yl]azetidine-1-carboxylate |
| SMILES | COCOc1cc(B2OC(C)(C)C(C)(C)O2)ccc1-c1ccc(C2CN(C(=O)OC(C)(C)C)C2)nn1 |
| InChI | InChI=1S/C26H36BN3O6/c1-24(2,3)34-23(31)30-14-17(15-30)20-11-12-21(29-28-20)19-10-9-18(13-22(19)33-16-32-8)27-35-25(4,5)26(6,7)36-27/h9-13,17H,14-16H2,1-8H3 |
| InChIKey | VIDXDURDEHMBIX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|