C27H40BN5O6 — CID 155772609
tert-butyl N-[1-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazin-3-yl]pyrrolidin-3-yl]-N-methylcarbamate (PubChem CID 155772609) has the molecular formula C27H40BN5O6 and a molecular weight of 541.46 g/mol. Its IUPAC name is tert-butyl N-[1-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazin-3-yl]pyrrolidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazin-3-yl]pyrrolidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155772609 |
| Molecular Formula | C27H40BN5O6 |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | tert-butyl N-[1-[6-[2-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazin-3-yl]pyrrolidin-3-yl]-N-methylcarbamate |
| SMILES | COCOc1cc(B2OC(C)(C)C(C)(C)O2)ccc1-c1cnc(N2CCC(N(C)C(=O)OC(C)(C)C)C2)nn1 |
| InChI | InChI=1S/C27H40BN5O6/c1-25(2,3)37-24(34)32(8)19-12-13-33(16-19)23-29-15-21(30-31-23)20-11-10-18(14-22(20)36-17-35-9)28-38-26(4,5)27(6,7)39-28/h10-11,14-15,19H,12-13,16-17H2,1-9H3 |
| InChIKey | CYVKZVFAGISMAW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 108.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|