C23H38BN5O5 — CID 99935010
tert-butyl N-[(2S)-1-oxo-1-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]amino]propan-2-yl]carbamate (PubChem CID 99935010) has the molecular formula C23H38BN5O5 and a molecular weight of 475.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 99935010 |
| Molecular Formula | C23H38BN5O5 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]amino]propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H]1CCCN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C23H38BN5O5/c1-15(27-20(31)32-21(2,3)4)18(30)28-17-10-9-11-29(14-17)19-25-12-16(13-26-19)24-33-22(5,6)23(7,8)34-24/h12-13,15,17H,9-11,14H2,1-8H3,(H,27,31)(H,28,30)/t15-,17+/m0/s1 |
| InChIKey | TXPZKOPSOQSCTO-DOTOQJQBSA-N |
| XLogP | 1.77 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|