C20H33BN4O4 — CID 99884489
tert-butyl N-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 99884489) has the molecular formula C20H33BN4O4 and a molecular weight of 404.32 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 99884489 |
| Molecular Formula | C20H33BN4O4 |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | tert-butyl N-[[(3R)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CCN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C20H33BN4O4/c1-18(2,3)27-17(26)24-10-14-8-9-25(13-14)16-22-11-15(12-23-16)21-28-19(4,5)20(6,7)29-21/h11-12,14H,8-10,13H2,1-7H3,(H,24,26)/t14-/m1/s1 |
| InChIKey | NYXRLNGSBDFRMG-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|