C23H35BF3N3O4 — CID 176906001
tert-butyl N-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]carbamate (PubChem CID 176906001) has the molecular formula C23H35BF3N3O4 and a molecular weight of 485.36 g/mol. Its IUPAC name is tert-butyl N-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176906001 |
| Molecular Formula | C23H35BF3N3O4 |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | tert-butyl N-[[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(c2ncc(B3OC(C)(C)C(C)(C)O3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H35BF3N3O4/c1-20(2,3)32-19(31)29-13-15-8-10-30(11-9-15)18-17(23(25,26)27)12-16(14-28-18)24-33-21(4,5)22(6,7)34-24/h12,14-15H,8-11,13H2,1-7H3,(H,29,31) |
| InChIKey | KFKDSFBIJKLIQG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|