C24H38BFN2O4 — CID 131743027
tert-butyl N-[[1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]carbamate (PubChem CID 131743027) has the molecular formula C24H38BFN2O4 and a molecular weight of 448.39 g/mol. Its IUPAC name is tert-butyl N-[[1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 131743027 |
| Molecular Formula | C24H38BFN2O4 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | tert-butyl N-[[1-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)CC1 |
| InChI | InChI=1S/C24H38BFN2O4/c1-22(2,3)30-21(29)27-15-17-10-12-28(13-11-17)16-18-8-9-19(14-20(18)26)25-31-23(4,5)24(6,7)32-25/h8-9,14,17H,10-13,15-16H2,1-7H3,(H,27,29) |
| InChIKey | TXKHQIPDQWWTIR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|