C23H37BN2O4 — CID 169422679
tert-butyl N-[1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-yl]carbamate (PubChem CID 169422679) has the molecular formula C23H37BN2O4 and a molecular weight of 416.37 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 169422679 |
| Molecular Formula | C23H37BN2O4 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | tert-butyl N-[1-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidin-3-yl]carbamate |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1CN1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H37BN2O4/c1-16-9-10-18(24-29-22(5,6)23(7,8)30-24)13-17(16)14-26-12-11-19(15-26)25-20(27)28-21(2,3)4/h9-10,13,19H,11-12,14-15H2,1-8H3,(H,25,27) |
| InChIKey | WQQIOABRDWGQLF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|