C24H39BN2O4 — CID 169422712
tert-butyl (3S)-3-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 169422712) has the molecular formula C24H39BN2O4 and a molecular weight of 430.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169422712 |
| Molecular Formula | C24H39BN2O4 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1CN1CCN(C(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C24H39BN2O4/c1-17-10-11-20(25-30-23(6,7)24(8,9)31-25)14-19(17)16-26-12-13-27(15-18(26)2)21(28)29-22(3,4)5/h10-11,14,18H,12-13,15-16H2,1-9H3/t18-/m0/s1 |
| InChIKey | NBEDRGADFDGNPV-SFHVURJKSA-N |
| XLogP | 3.74 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|