C18H27BrN2O3 — CID 168510183
tert-butyl (3S)-4-[(4-bromo-2-methoxyphenyl)methyl]-3-methylpiperazine-1-carboxylate (PubChem CID 168510183) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(4-bromo-2-methoxyphenyl)methyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[(4-bromo-2-methoxyphenyl)methyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 168510183 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | tert-butyl (3S)-4-[(4-bromo-2-methoxyphenyl)methyl]-3-methylpiperazine-1-carboxylate |
| SMILES | COc1cc(Br)ccc1CN1CCN(C(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C18H27BrN2O3/c1-13-11-21(17(22)24-18(2,3)4)9-8-20(13)12-14-6-7-15(19)10-16(14)23-5/h6-7,10,13H,8-9,11-12H2,1-5H3/t13-/m0/s1 |
| InChIKey | AHIFJZBAXVMGMO-ZDUSSCGKSA-N |
| XLogP | 3.90 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |