C16H24BrN3O3 — CID 118555311
tert-butyl 4-(6-bromo-5-methoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate (PubChem CID 118555311) has the molecular formula C16H24BrN3O3 and a molecular weight of 386.29 g/mol. Its IUPAC name is tert-butyl 4-(6-bromo-5-methoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-bromo-5-methoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 118555311 |
| Molecular Formula | C16H24BrN3O3 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | tert-butyl 4-(6-bromo-5-methoxy-2-pyridinyl)-3-methylpiperazine-1-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2C)nc1Br |
| InChI | InChI=1S/C16H24BrN3O3/c1-11-10-19(15(21)23-16(2,3)4)8-9-20(11)13-7-6-12(22-5)14(17)18-13/h6-7,11H,8-10H2,1-5H3 |
| InChIKey | NGMCXYNVLLJQOO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|