C14H22N4O2 — CID 95247753
tert-butyl (3S)-3-methyl-4-pyrimidin-2-ylpiperazine-1-carboxylate (PubChem CID 95247753) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-pyrimidin-2-ylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-pyrimidin-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 95247753 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-pyrimidin-2-ylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1c1ncccn1 |
| InChI | InChI=1S/C14H22N4O2/c1-11-10-17(13(19)20-14(2,3)4)8-9-18(11)12-15-6-5-7-16-12/h5-7,11H,8-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | KONKFGAPICIZMZ-NSHDSACASA-N |
| XLogP | 1.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |