C16H22Cl2N2O2 — CID 166075296
tert-butyl 4-(3,5-dichlorophenyl)-3-methylpiperazine-1-carboxylate (PubChem CID 166075296) has the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.27 g/mol. Its IUPAC name is tert-butyl 4-(3,5-dichlorophenyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3,5-dichlorophenyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 166075296 |
| Molecular Formula | C16H22Cl2N2O2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | tert-butyl 4-(3,5-dichlorophenyl)-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N2O2/c1-11-10-19(15(21)22-16(2,3)4)5-6-20(11)14-8-12(17)7-13(18)9-14/h7-9,11H,5-6,10H2,1-4H3 |
| InChIKey | PVFBCMATLVOXHJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |