C16H23FN2O2 — CID 166723804
tert-butyl 4-(3-fluorophenyl)-3-methylpiperazine-1-carboxylate (PubChem CID 166723804) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is tert-butyl 4-(3-fluorophenyl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-fluorophenyl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 166723804 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | tert-butyl 4-(3-fluorophenyl)-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1cccc(F)c1 |
| InChI | InChI=1S/C16H23FN2O2/c1-12-11-18(15(20)21-16(2,3)4)8-9-19(12)14-7-5-6-13(17)10-14/h5-7,10,12H,8-9,11H2,1-4H3 |
| InChIKey | UCNHHAADGQTYTI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |